C21H30F2N2O4 — CID 11235296
(E)-N-[(5S,6S)-6-acetamido-7-(3,5-difluorophenyl)-1,5-dihydroxyheptan-3-yl]hex-3-enamide (PubChem CID 11235296) has the molecular formula C21H30F2N2O4 and a molecular weight of 412.48 g/mol. Its IUPAC name is (E)-N-[(5S,6S)-6-acetamido-7-(3,5-difluorophenyl)-1,5-dihydroxyheptan-3-yl]hex-3-enamide.
| Compound Name | (E)-N-[(5S,6S)-6-acetamido-7-(3,5-difluorophenyl)-1,5-dihydroxyheptan-3-yl]hex-3-enamide |
|---|---|
| PubChem CID | 11235296 |
| Molecular Formula | C21H30F2N2O4 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (E)-N-[(5S,6S)-6-acetamido-7-(3,5-difluorophenyl)-1,5-dihydroxyheptan-3-yl]hex-3-enamide |
| SMILES | CC/C=C/CC(=O)NC(CCO)C[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(C)=O |
| InChI | InChI=1S/C21H30F2N2O4/c1-3-4-5-6-21(29)25-18(7-8-26)13-20(28)19(24-14(2)27)11-15-9-16(22)12-17(23)10-15/h4-5,9-10,12,18-20,26,28H,3,6-8,11,13H2,1-2H3,(H,24,27)(H,25,29)/b5-4+/t18?,19-,20-/m0/s1 |
| InChIKey | SILVENDAHNQSFU-UHFVYCGKSA-N |
| XLogP | 1.99 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|