C16H24ClF3N2O5 — CID 11235416
(2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-[(Z)-2-chloroethenyl]pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 11235416) has the molecular formula C16H24ClF3N2O5 and a molecular weight of 416.82 g/mol. Its IUPAC name is (2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-[(Z)-2-chloroethenyl]pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-[(Z)-2-chloroethenyl]pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11235416 |
| Molecular Formula | C16H24ClF3N2O5 |
| Molecular Weight | 416.82 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-[(Z)-2-chloroethenyl]pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1/C=C\Cl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H23ClN2O3.C2HF3O2/c1-8(2)6-11(16-9(3)18)13-10(4-5-15)7-12(17-13)14(19)20;3-2(4,5)1(6)7/h4-5,8,10-13,17H,6-7H2,1-3H3,(H,16,18)(H,19,20);(H,6,7)/b5-4-;/t10-,11+,12-,13-;/m1./s1 |
| InChIKey | DVYCSLFCAMKBFP-PGKJXQIASA-N |
| XLogP | 2.35 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.82 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |