About 4-cyclopropyl-6-(3,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide
4-cyclopropyl-6-(3,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide (PubChem CID 11235490) has the molecular formula C21H23Cl2N3O2
and a molecular weight of 420.34 g/mol. Its IUPAC name is 4-cyclopropyl-6-(3,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 4-cyclopropyl-6-(3,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide |
| PubChem CID | 11235490 |
| Molecular Formula | C21H23Cl2N3O2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 4-cyclopropyl-6-(3,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCOCC1)c1cnc(Nc2ccc(Cl)c(Cl)c2)cc1C1CC1 |
| InChI | InChI=1S/C21H23Cl2N3O2/c22-18-4-3-15(9-19(18)23)26-20-10-16(14-1-2-14)17(12-24-20)21(27)25-11-13-5-7-28-8-6-13/h3-4,9-10,12-14H,1-2,5-8,11H2,(H,24,26)(H,25,27) |
| InChIKey | RIJPPXXYGWDYJW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyclopropyl-6-(3,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-6-(3,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide?
The IUPAC name of 4-cyclopropyl-6-(3,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide (CID 11235490) is 4-cyclopropyl-6-(3,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide.
What is the SMILES notation for 4-cyclopropyl-6-(3,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide?
The canonical SMILES for 4-cyclopropyl-6-(3,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide is O=C(NCC1CCOCC1)c1cnc(Nc2ccc(Cl)c(Cl)c2)cc1C1CC1.
What is the InChIKey of 4-cyclopropyl-6-(3,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide?
The InChIKey is RIJPPXXYGWDYJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23Cl2N3O2/c22-18-4-3-15(9-19(18)23)26-20-10-16(14-1-2-14)17(12-24-20)21(27)25-11-13-5-7-28-8-6-13/h3-4,9-10,12-14H,1-2,5-8,11H2,(H,24,26)(H,25,27).
What are the key properties of 4-cyclopropyl-6-(3,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide?
4-cyclopropyl-6-(3,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide has a molecular weight of 420.34 g/mol, XLogP of 5.17, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-6-(3,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide is sourced from PubChem (CID 11235490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).