C25H18F3N3O — CID 11235849
N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)-2,3,6-trifluorobenzamide (PubChem CID 11235849) has the molecular formula C25H18F3N3O and a molecular weight of 433.43 g/mol. Its IUPAC name is N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)-2,3,6-trifluorobenzamide.
| Compound Name | N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)-2,3,6-trifluorobenzamide |
|---|---|
| PubChem CID | 11235849 |
| Molecular Formula | C25H18F3N3O |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)-2,3,6-trifluorobenzamide |
| SMILES | O=C(Nc1c2c(nc3ccccc13)N(Cc1ccccc1)CC2)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C25H18F3N3O/c26-18-10-11-19(27)22(28)21(18)25(32)30-23-16-8-4-5-9-20(16)29-24-17(23)12-13-31(24)14-15-6-2-1-3-7-15/h1-11H,12-14H2,(H,29,30,32) |
| InChIKey | HPAYMJNJUUZFNW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|