C21H30F2N4O4 — CID 11236020
(2S)-N-(2-cyclopentylethyl)-2-[(2,5-difluorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3-methylbutanamide (PubChem CID 11236020) has the molecular formula C21H30F2N4O4 and a molecular weight of 440.49 g/mol. Its IUPAC name is (2S)-N-(2-cyclopentylethyl)-2-[(2,5-difluorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3-methylbutanamide.
| Compound Name | (2S)-N-(2-cyclopentylethyl)-2-[(2,5-difluorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 11236020 |
| Molecular Formula | C21H30F2N4O4 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (2S)-N-(2-cyclopentylethyl)-2-[(2,5-difluorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](NC(=O)Nc1cc(F)ccc1F)C(=O)N(CCC1CCCC1)CC(=O)NO |
| InChI | InChI=1S/C21H30F2N4O4/c1-13(2)19(25-21(30)24-17-11-15(22)7-8-16(17)23)20(29)27(12-18(28)26-31)10-9-14-5-3-4-6-14/h7-8,11,13-14,19,31H,3-6,9-10,12H2,1-2H3,(H,26,28)(H2,24,25,30)/t19-/m0/s1 |
| InChIKey | IXCCLHVLLUJSGJ-IBGZPJMESA-N |
| XLogP | 3.03 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|