C25H37NO4Si — CID 11236116
(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N,4-dimethoxy-N,2-dimethylpentanamide (PubChem CID 11236116) has the molecular formula C25H37NO4Si and a molecular weight of 443.66 g/mol. Its IUPAC name is (2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N,4-dimethoxy-N,2-dimethylpentanamide.
| Compound Name | (2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N,4-dimethoxy-N,2-dimethylpentanamide |
|---|---|
| PubChem CID | 11236116 |
| Molecular Formula | C25H37NO4Si |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | (2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N,4-dimethoxy-N,2-dimethylpentanamide |
| SMILES | CO[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@H](C)C(=O)N(C)OC |
| InChI | InChI=1S/C25H37NO4Si/c1-20(24(27)26(5)29-7)18-21(28-6)19-30-31(25(2,3)4,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,20-21H,18-19H2,1-7H3/t20-,21+/m0/s1 |
| InChIKey | TUASWEHXQYBMGZ-LEWJYISDSA-N |
| XLogP | 3.62 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|