C16H13BBrF4N3O2 — CID 11236176
2'-(4-bromophenyl)spiro[2,3-dihydrochromene-4,5'-4H-1,2,4-triazol-2-ium]-3'-one tetrafluoroborate (PubChem CID 11236176) has the molecular formula C16H13BBrF4N3O2 and a molecular weight of 446.01 g/mol. Its IUPAC name is 2'-(4-bromophenyl)spiro[2,3-dihydrochromene-4,5'-4H-1,2,4-triazol-2-ium]-3'-one tetrafluoroborate.
| Compound Name | 2'-(4-bromophenyl)spiro[2,3-dihydrochromene-4,5'-4H-1,2,4-triazol-2-ium]-3'-one tetrafluoroborate |
|---|---|
| PubChem CID | 11236176 |
| Molecular Formula | C16H13BBrF4N3O2 |
| Molecular Weight | 446.01 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 2'-(4-bromophenyl)spiro[2,3-dihydrochromene-4,5'-4H-1,2,4-triazol-2-ium]-3'-one tetrafluoroborate |
| SMILES | F[B-](F)(F)F.O=C1NC2(CCOc3ccccc32)N=[N+]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H12BrN3O2.BF4/c17-11-5-7-12(8-6-11)20-15(21)18-16(19-20)9-10-22-14-4-2-1-3-13(14)16;2-1(3,4)5/h1-8H,9-10H2;/q;-1/p+1 |
| InChIKey | OMYNDGJMIUWYJA-UHFFFAOYSA-O |
| XLogP | 5.20 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.01 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|