C24H30F2N2O4 — CID 11236229
N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-1,4-dihydroxyhexan-2-yl]-4-phenylbutanamide (PubChem CID 11236229) has the molecular formula C24H30F2N2O4 and a molecular weight of 448.51 g/mol. Its IUPAC name is N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-1,4-dihydroxyhexan-2-yl]-4-phenylbutanamide.
| Compound Name | N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-1,4-dihydroxyhexan-2-yl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 11236229 |
| Molecular Formula | C24H30F2N2O4 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-1,4-dihydroxyhexan-2-yl]-4-phenylbutanamide |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@@H](O)CC(CO)NC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C24H30F2N2O4/c1-16(30)27-22(12-18-10-19(25)13-20(26)11-18)23(31)14-21(15-29)28-24(32)9-5-8-17-6-3-2-4-7-17/h2-4,6-7,10-11,13,21-23,29,31H,5,8-9,12,14-15H2,1H3,(H,27,30)(H,28,32)/t21?,22-,23-/m0/s1 |
| InChIKey | PKLYWLZEAVBPGS-KXNJDZORSA-N |
| XLogP | 2.26 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |