C22H29F2N5O3 — CID 11236256
tert-butyl N-[(2R)-1-(3,4-difluorophenyl)-4-(3-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-oxobutan-2-yl]carbamate (PubChem CID 11236256) has the molecular formula C22H29F2N5O3 and a molecular weight of 449.50 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(3,4-difluorophenyl)-4-(3-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(3,4-difluorophenyl)-4-(3-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 11236256 |
| Molecular Formula | C22H29F2N5O3 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | tert-butyl N-[(2R)-1-(3,4-difluorophenyl)-4-(3-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-oxobutan-2-yl]carbamate |
| SMILES | CCc1nnc2n1CCN(C(=O)C[C@@H](Cc1ccc(F)c(F)c1)NC(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C22H29F2N5O3/c1-5-18-26-27-19-13-28(8-9-29(18)19)20(30)12-15(25-21(31)32-22(2,3)4)10-14-6-7-16(23)17(24)11-14/h6-7,11,15H,5,8-10,12-13H2,1-4H3,(H,25,31)/t15-/m1/s1 |
| InChIKey | KAWQVKBVTQKAOP-OAHLLOKOSA-N |
| XLogP | 2.99 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |