C27H27FN2O5 — CID 11236923
2-[3-[[1,3-benzoxazol-2-yl-[3-(4-fluorophenoxy)propyl]amino]methyl]phenoxy]butanoic acid (PubChem CID 11236923) has the molecular formula C27H27FN2O5 and a molecular weight of 478.52 g/mol. Its IUPAC name is 2-[3-[[1,3-benzoxazol-2-yl-[3-(4-fluorophenoxy)propyl]amino]methyl]phenoxy]butanoic acid.
| Compound Name | 2-[3-[[1,3-benzoxazol-2-yl-[3-(4-fluorophenoxy)propyl]amino]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 11236923 |
| Molecular Formula | C27H27FN2O5 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-[3-[[1,3-benzoxazol-2-yl-[3-(4-fluorophenoxy)propyl]amino]methyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1cccc(CN(CCCOc2ccc(F)cc2)c2nc3ccccc3o2)c1)C(=O)O |
| InChI | InChI=1S/C27H27FN2O5/c1-2-24(26(31)32)34-22-8-5-7-19(17-22)18-30(27-29-23-9-3-4-10-25(23)35-27)15-6-16-33-21-13-11-20(28)12-14-21/h3-5,7-14,17,24H,2,6,15-16,18H2,1H3,(H,31,32) |
| InChIKey | FEIXPYZPYIUNRN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|