C25H38N4O6 — CID 11237184
2-[(3S,13S,16S,17R,19S)-3-formamido-18,18-dimethyl-2,15-dioxo-5-oxa-1,14-diazatricyclo[14.4.0.017,19]icosan-13-yl]-2-oxo-N-prop-2-enylacetamide (PubChem CID 11237184) has the molecular formula C25H38N4O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is 2-[(3S,13S,16S,17R,19S)-3-formamido-18,18-dimethyl-2,15-dioxo-5-oxa-1,14-diazatricyclo[14.4.0.017,19]icosan-13-yl]-2-oxo-N-prop-2-enylacetamide.
| Compound Name | 2-[(3S,13S,16S,17R,19S)-3-formamido-18,18-dimethyl-2,15-dioxo-5-oxa-1,14-diazatricyclo[14.4.0.017,19]icosan-13-yl]-2-oxo-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 11237184 |
| Molecular Formula | C25H38N4O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 2-[(3S,13S,16S,17R,19S)-3-formamido-18,18-dimethyl-2,15-dioxo-5-oxa-1,14-diazatricyclo[14.4.0.017,19]icosan-13-yl]-2-oxo-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)C(=O)[C@@H]1CCCCCCCOC[C@H](NC=O)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)N1)C3(C)C |
| InChI | InChI=1S/C25H38N4O6/c1-4-11-26-23(33)21(31)17-10-8-6-5-7-9-12-35-14-18(27-15-30)24(34)29-13-16-19(25(16,2)3)20(29)22(32)28-17/h4,15-20H,1,5-14H2,2-3H3,(H,26,33)(H,27,30)(H,28,32)/t16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | WODMGHZISACVBJ-HVTWWXFQSA-N |
| XLogP | 0.31 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|