C29H26N4O4 — CID 11237253
N-[2-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]ethyl]acridine-4-carboxamide (PubChem CID 11237253) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is N-[2-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]ethyl]acridine-4-carboxamide.
| Compound Name | N-[2-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]ethyl]acridine-4-carboxamide |
|---|---|
| PubChem CID | 11237253 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | N-[2-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]ethyl]acridine-4-carboxamide |
| SMILES | COc1cc2c(cc1OCCNC(=O)c1cccc3cc4ccccc4nc13)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C29H26N4O4/c1-36-25-15-22-24(31-17-20-8-5-12-33(20)29(22)35)16-26(25)37-13-11-30-28(34)21-9-4-7-19-14-18-6-2-3-10-23(18)32-27(19)21/h2-4,6-7,9-10,14-17,20H,5,8,11-13H2,1H3,(H,30,34)/t20-/m0/s1 |
| InChIKey | MEVICIBVAINNRK-FQEVSTJZSA-N |
| XLogP | 4.53 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|