About ethyl 2-[(2S,3R)-2-(benzenesulfonylmethyl)-3-tri(propan-2-yl)silyloxypiperidin-1-yl]acetate
ethyl 2-[(2S,3R)-2-(benzenesulfonylmethyl)-3-tri(propan-2-yl)silyloxypiperidin-1-yl]acetate (PubChem CID 11237320) has the molecular formula C25H43NO5SSi
and a molecular weight of 497.77 g/mol. Its IUPAC name is ethyl 2-[(2S,3R)-2-(benzenesulfonylmethyl)-3-tri(propan-2-yl)silyloxypiperidin-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(2S,3R)-2-(benzenesulfonylmethyl)-3-tri(propan-2-yl)silyloxypiperidin-1-yl]acetate |
| PubChem CID | 11237320 |
| Molecular Formula | C25H43NO5SSi |
| Molecular Weight | 497.77 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | ethyl 2-[(2S,3R)-2-(benzenesulfonylmethyl)-3-tri(propan-2-yl)silyloxypiperidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H43NO5SSi/c1-8-30-25(27)17-26-16-12-15-24(31-33(19(2)3,20(4)5)21(6)7)23(26)18-32(28,29)22-13-10-9-11-14-22/h9-11,13-14,19-21,23-24H,8,12,15-18H2,1-7H3/t23-,24-/m1/s1 |
| InChIKey | XLFLDUIIOFACNP-DNQXCXABSA-N |
| XLogP | 5.05 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.77 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(2S,3R)-2-(benzenesulfonylmethyl)-3-tri(propan-2-yl)silyloxypiperidin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2S,3R)-2-(benzenesulfonylmethyl)-3-tri(propan-2-yl)silyloxypiperidin-1-yl]acetate?
The IUPAC name of ethyl 2-[(2S,3R)-2-(benzenesulfonylmethyl)-3-tri(propan-2-yl)silyloxypiperidin-1-yl]acetate (CID 11237320) is ethyl 2-[(2S,3R)-2-(benzenesulfonylmethyl)-3-tri(propan-2-yl)silyloxypiperidin-1-yl]acetate.
What is the SMILES notation for ethyl 2-[(2S,3R)-2-(benzenesulfonylmethyl)-3-tri(propan-2-yl)silyloxypiperidin-1-yl]acetate?
The canonical SMILES for ethyl 2-[(2S,3R)-2-(benzenesulfonylmethyl)-3-tri(propan-2-yl)silyloxypiperidin-1-yl]acetate is CCOC(=O)CN1CCC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1CS(=O)(=O)c1ccccc1.
What is the InChIKey of ethyl 2-[(2S,3R)-2-(benzenesulfonylmethyl)-3-tri(propan-2-yl)silyloxypiperidin-1-yl]acetate?
The InChIKey is XLFLDUIIOFACNP-DNQXCXABSA-N. The full InChI is InChI=1S/C25H43NO5SSi/c1-8-30-25(27)17-26-16-12-15-24(31-33(19(2)3,20(4)5)21(6)7)23(26)18-32(28,29)22-13-10-9-11-14-22/h9-11,13-14,19-21,23-24H,8,12,15-18H2,1-7H3/t23-,24-/m1/s1.
What are the key properties of ethyl 2-[(2S,3R)-2-(benzenesulfonylmethyl)-3-tri(propan-2-yl)silyloxypiperidin-1-yl]acetate?
ethyl 2-[(2S,3R)-2-(benzenesulfonylmethyl)-3-tri(propan-2-yl)silyloxypiperidin-1-yl]acetate has a molecular weight of 497.77 g/mol, XLogP of 5.05, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2S,3R)-2-(benzenesulfonylmethyl)-3-tri(propan-2-yl)silyloxypiperidin-1-yl]acetate is sourced from PubChem (CID 11237320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).