C26H35Cl2N5O — CID 11237444
4-[[N'-(2-amino-2-methylpropyl)-N-cyclohexylcarbamimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide (PubChem CID 11237444) has the molecular formula C26H35Cl2N5O and a molecular weight of 504.51 g/mol. Its IUPAC name is 4-[[N'-(2-amino-2-methylpropyl)-N-cyclohexylcarbamimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide.
| Compound Name | 4-[[N'-(2-amino-2-methylpropyl)-N-cyclohexylcarbamimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 11237444 |
| Molecular Formula | C26H35Cl2N5O |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 4-[[N'-(2-amino-2-methylpropyl)-N-cyclohexylcarbamimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
| SMILES | CC(C)(N)C/N=C(/Nc1ccc(C(=O)NCCc2ccc(Cl)cc2Cl)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C26H35Cl2N5O/c1-26(2,29)17-31-25(32-21-6-4-3-5-7-21)33-22-12-9-19(10-13-22)24(34)30-15-14-18-8-11-20(27)16-23(18)28/h8-13,16,21H,3-7,14-15,17,29H2,1-2H3,(H,30,34)(H2,31,32,33) |
| InChIKey | VOAHDPCQCTZCKL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|