C28H26BrO2P — CID 11237464
4-bromo-6-tert-butyl-2,2,2-triphenyl-1,3,2λ5-benzodioxaphosphole (PubChem CID 11237464) has the molecular formula C28H26BrO2P and a molecular weight of 505.39 g/mol. Its IUPAC name is 4-bromo-6-tert-butyl-2,2,2-triphenyl-1,3,2λ5-benzodioxaphosphole.
| Compound Name | 4-bromo-6-tert-butyl-2,2,2-triphenyl-1,3,2λ5-benzodioxaphosphole |
|---|---|
| PubChem CID | 11237464 |
| Molecular Formula | C28H26BrO2P |
| Molecular Weight | 505.39 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | 4-bromo-6-tert-butyl-2,2,2-triphenyl-1,3,2λ5-benzodioxaphosphole |
| SMILES | CC(C)(C)c1cc(Br)c2c(c1)OP(c1ccccc1)(c1ccccc1)(c1ccccc1)O2 |
| InChI | InChI=1S/C28H26BrO2P/c1-28(2,3)21-19-25(29)27-26(20-21)30-32(31-27,22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-20H,1-3H3 |
| InChIKey | CRJWFJBQHHJEGW-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.39 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|