C25H26N6O4S — CID 11237489
N-(1,3-benzodioxol-5-ylmethyl)-4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioamide (PubChem CID 11237489) has the molecular formula C25H26N6O4S and a molecular weight of 506.59 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 11237489 |
| Molecular Formula | C25H26N6O4S |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioamide |
| SMILES | COc1cc2[nH]c3ncnc(N4CCN(C(=S)NCc5ccc6c(c5)OCO6)CC4)c3c2cc1OC |
| InChI | InChI=1S/C25H26N6O4S/c1-32-19-10-16-17(11-20(19)33-2)29-23-22(16)24(28-13-27-23)30-5-7-31(8-6-30)25(36)26-12-15-3-4-18-21(9-15)35-14-34-18/h3-4,9-11,13H,5-8,12,14H2,1-2H3,(H,26,36)(H,27,28,29) |
| InChIKey | YVWCAAQIEDOOLZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|