C32H33N3O5 — CID 11238021
21-[2-[benzyl(tert-butyl)amino]ethyl]-16,17-dimethoxy-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-20-one (PubChem CID 11238021) has the molecular formula C32H33N3O5 and a molecular weight of 539.63 g/mol. Its IUPAC name is 21-[2-[benzyl(tert-butyl)amino]ethyl]-16,17-dimethoxy-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-20-one.
| Compound Name | 21-[2-[benzyl(tert-butyl)amino]ethyl]-16,17-dimethoxy-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-20-one |
|---|---|
| PubChem CID | 11238021 |
| Molecular Formula | C32H33N3O5 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 21-[2-[benzyl(tert-butyl)amino]ethyl]-16,17-dimethoxy-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-20-one |
| SMILES | COc1cc2c(=O)n(CCN(Cc3ccccc3)C(C)(C)C)c3c4cc5c(cc4ncc3c2cc1OC)OCO5 |
| InChI | InChI=1S/C32H33N3O5/c1-32(2,3)34(18-20-9-7-6-8-10-20)11-12-35-30-23-15-28-29(40-19-39-28)16-25(23)33-17-24(30)21-13-26(37-4)27(38-5)14-22(21)31(35)36/h6-10,13-17H,11-12,18-19H2,1-5H3 |
| InChIKey | JXLPQNBZAHZTEV-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|