C31H54O5Si2 — CID 11238361
methyl 2-[(1S,3aS,5aR,6R,7R,8S,8aR,8bS)-2-acetyl-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,7-dimethyl-1,3a,5a,6,7,8,8a,8b-octahydro-as-indacen-1-yl]acetate (PubChem CID 11238361) has the molecular formula C31H54O5Si2 and a molecular weight of 562.94 g/mol. Its IUPAC name is methyl 2-[(1S,3aS,5aR,6R,7R,8S,8aR,8bS)-2-acetyl-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,7-dimethyl-1,3a,5a,6,7,8,8a,8b-octahydro-as-indacen-1-yl]acetate.
| Compound Name | methyl 2-[(1S,3aS,5aR,6R,7R,8S,8aR,8bS)-2-acetyl-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,7-dimethyl-1,3a,5a,6,7,8,8a,8b-octahydro-as-indacen-1-yl]acetate |
|---|---|
| PubChem CID | 11238361 |
| Molecular Formula | C31H54O5Si2 |
| Molecular Weight | 562.94 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | methyl 2-[(1S,3aS,5aR,6R,7R,8S,8aR,8bS)-2-acetyl-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,7-dimethyl-1,3a,5a,6,7,8,8a,8b-octahydro-as-indacen-1-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C(C(C)=O)=C[C@H]2C(C)=C[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C31H54O5Si2/c1-18-15-24-27(26-21(18)16-22(20(3)32)23(26)17-25(33)34-10)29(36-38(13,14)31(7,8)9)19(2)28(24)35-37(11,12)30(4,5)6/h15-16,19,21,23-24,26-29H,17H2,1-14H3/t19-,21-,23+,24+,26+,27-,28-,29+/m0/s1 |
| InChIKey | KSGYNAZHHVMKFV-ZIBXWQRGSA-N |
| XLogP | 7.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.94 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|