C31H28ClF2N5O3 — CID 11238694
(E)-N-[4-[3-chloro-4-[(2,4-difluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 11238694) has the molecular formula C31H28ClF2N5O3 and a molecular weight of 592.05 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-[(2,4-difluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-[(2,4-difluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 11238694 |
| Molecular Formula | C31H28ClF2N5O3 |
| Molecular Weight | 592.05 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-[(2,4-difluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(OCc4ccc(F)cc4F)c(Cl)c3)c2cc1NC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C31H28ClF2N5O3/c1-4-41-29-15-26-23(14-27(29)38-30(40)6-5-11-39(2)3)31(20(16-35)17-36-26)37-22-9-10-28(24(32)13-22)42-18-19-7-8-21(33)12-25(19)34/h5-10,12-15,17H,4,11,18H2,1-3H3,(H,36,37)(H,38,40)/b6-5+ |
| InChIKey | UTHCWAKCUYYOJY-AATRIKPKSA-N |
| XLogP | 6.82 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.05 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|