C29H21F5N8O — CID 11238696
4-[4-(4-methylpiperazin-1-yl)anilino]-9-(2,3,4,5,6-pentafluorophenyl)-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one (PubChem CID 11238696) has the molecular formula C29H21F5N8O and a molecular weight of 592.53 g/mol. Its IUPAC name is 4-[4-(4-methylpiperazin-1-yl)anilino]-9-(2,3,4,5,6-pentafluorophenyl)-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one.
| Compound Name | 4-[4-(4-methylpiperazin-1-yl)anilino]-9-(2,3,4,5,6-pentafluorophenyl)-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one |
|---|---|
| PubChem CID | 11238696 |
| Molecular Formula | C29H21F5N8O |
| Molecular Weight | 592.53 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | 4-[4-(4-methylpiperazin-1-yl)anilino]-9-(2,3,4,5,6-pentafluorophenyl)-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(=O)n(-c5c(F)c(F)c(F)c(F)c5F)c5nc6ccccc6n5c4n3)cc2)CC1 |
| InChI | InChI=1S/C29H21F5N8O/c1-39-10-12-40(13-11-39)16-8-6-15(7-9-16)36-28-35-14-17-26(38-28)41-19-5-3-2-4-18(19)37-29(41)42(27(17)43)25-23(33)21(31)20(30)22(32)24(25)34/h2-9,14H,10-13H2,1H3,(H,35,36,38) |
| InChIKey | BHZBHRORVGBRHE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 83.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|