C35H53NO5Si — CID 11238734
(5S)-11-[4-[2-(diethylamino)ethoxy]phenyl]-13-methyl-17-trimethylsilyloxyspiro[1,2,4,6,7,8,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-5-ol (PubChem CID 11238734) has the molecular formula C35H53NO5Si and a molecular weight of 595.90 g/mol. Its IUPAC name is (5S)-11-[4-[2-(diethylamino)ethoxy]phenyl]-13-methyl-17-trimethylsilyloxyspiro[1,2,4,6,7,8,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-5-ol.
| Compound Name | (5S)-11-[4-[2-(diethylamino)ethoxy]phenyl]-13-methyl-17-trimethylsilyloxyspiro[1,2,4,6,7,8,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-5-ol |
|---|---|
| PubChem CID | 11238734 |
| Molecular Formula | C35H53NO5Si |
| Molecular Weight | 595.90 g/mol |
| Exact Mass | 595.37 |
| IUPAC Name | (5S)-11-[4-[2-(diethylamino)ethoxy]phenyl]-13-methyl-17-trimethylsilyloxyspiro[1,2,4,6,7,8,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-5-ol |
| SMILES | CCN(CC)CCOc1ccc(C2CC3(C)C(O[Si](C)(C)C)=CCC3C3CC[C@]4(O)CC5(CCC4=C23)OCCO5)cc1 |
| InChI | InChI=1S/C35H53NO5Si/c1-7-36(8-2)19-20-38-26-11-9-25(10-12-26)28-23-33(3)29(13-14-31(33)41-42(4,5)6)27-15-17-34(37)24-35(39-21-22-40-35)18-16-30(34)32(27)28/h9-12,14,27-29,37H,7-8,13,15-24H2,1-6H3/t27?,28?,29?,33?,34-/m0/s1 |
| InChIKey | FIMLZTNKVIFZTP-NLGMMDPKSA-N |
| XLogP | 7.02 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.90 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|