C20H37ClN12O — CID 11238818
3,5-diamino-6-chloro-N-[N'-[4-[4-[5-(diaminomethylideneamino)pentyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 11238818) has the molecular formula C20H37ClN12O and a molecular weight of 497.05 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[5-(diaminomethylideneamino)pentyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[5-(diaminomethylideneamino)pentyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11238818 |
| Molecular Formula | C20H37ClN12O |
| Molecular Weight | 497.05 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[5-(diaminomethylideneamino)pentyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | NC(N)=NCCCCCN1CCN(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)CC1 |
| InChI | InChI=1S/C20H37ClN12O/c21-15-17(23)30-16(22)14(29-15)18(34)31-20(26)28-7-3-5-9-33-12-10-32(11-13-33)8-4-1-2-6-27-19(24)25/h1-13H2,(H4,22,23,30)(H4,24,25,27)(H3,26,28,31,34) |
| InChIKey | BPLDPODCHOGNOP-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 216.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.05 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|