C29H53IO5Si — CID 11239097
2-[(2R,3S,6R,8S,11R)-11-iodo-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undec-4-en-8-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 11239097) has the molecular formula C29H53IO5Si and a molecular weight of 636.73 g/mol. Its IUPAC name is 2-[(2R,3S,6R,8S,11R)-11-iodo-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undec-4-en-8-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(2R,3S,6R,8S,11R)-11-iodo-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undec-4-en-8-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11239097 |
| Molecular Formula | C29H53IO5Si |
| Molecular Weight | 636.73 g/mol |
| Exact Mass | 636.27 |
| IUPAC Name | 2-[(2R,3S,6R,8S,11R)-11-iodo-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undec-4-en-8-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)[Si](OCCC[C@H]1O[C@@]2(C=C[C@@H]1C)O[C@H](CCOC(=O)C(C)(C)C)CC[C@H]2I)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H53IO5Si/c1-20(2)36(21(3)4,22(5)6)33-18-11-12-25-23(7)15-17-29(35-25)26(30)14-13-24(34-29)16-19-32-27(31)28(8,9)10/h15,17,20-26H,11-14,16,18-19H2,1-10H3/t23-,24-,25+,26+,29+/m0/s1 |
| InChIKey | BLGNJXPZRXQTJD-GXDGBRLQSA-N |
| XLogP | 8.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.73 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|