C38H60O5Si2 — CID 11239201
[(2S,3R,3aR,4S,8S,8aS)-2-[tert-butyl(diphenyl)silyl]oxy-5-ethoxy-8-(methoxymethoxy)-3,8-dimethyl-2,3,3a,4,7,8a-hexahydro-1H-azulen-4-yl]oxy-triethylsilane (PubChem CID 11239201) has the molecular formula C38H60O5Si2 and a molecular weight of 653.07 g/mol. Its IUPAC name is [(2S,3R,3aR,4S,8S,8aS)-2-[tert-butyl(diphenyl)silyl]oxy-5-ethoxy-8-(methoxymethoxy)-3,8-dimethyl-2,3,3a,4,7,8a-hexahydro-1H-azulen-4-yl]oxy-triethylsilane.
| Compound Name | [(2S,3R,3aR,4S,8S,8aS)-2-[tert-butyl(diphenyl)silyl]oxy-5-ethoxy-8-(methoxymethoxy)-3,8-dimethyl-2,3,3a,4,7,8a-hexahydro-1H-azulen-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 11239201 |
| Molecular Formula | C38H60O5Si2 |
| Molecular Weight | 653.07 g/mol |
| Exact Mass | 652.40 |
| IUPAC Name | [(2S,3R,3aR,4S,8S,8aS)-2-[tert-butyl(diphenyl)silyl]oxy-5-ethoxy-8-(methoxymethoxy)-3,8-dimethyl-2,3,3a,4,7,8a-hexahydro-1H-azulen-4-yl]oxy-triethylsilane |
| SMILES | CCOC1=CC[C@](C)(OCOC)[C@H]2C[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](C)[C@H]2[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C38H60O5Si2/c1-11-40-33-25-26-38(9,41-28-39-10)32-27-34(29(5)35(32)36(33)43-44(12-2,13-3)14-4)42-45(37(6,7)8,30-21-17-15-18-22-30)31-23-19-16-20-24-31/h15-25,29,32,34-36H,11-14,26-28H2,1-10H3/t29-,32-,34-,35+,36+,38-/m0/s1 |
| InChIKey | QVIMUHCYRJFIKY-QZBLJVFISA-N |
| XLogP | 8.30 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.07 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|