C30H59F3O7SSi2 — CID 11239329
[(2R,13R)-2,13-bis[[tert-butyl(dimethyl)silyl]oxy]-13-[(2R)-5-oxooxolan-2-yl]tridecyl] trifluoromethanesulfonate (PubChem CID 11239329) has the molecular formula C30H59F3O7SSi2 and a molecular weight of 677.03 g/mol. Its IUPAC name is [(2R,13R)-2,13-bis[[tert-butyl(dimethyl)silyl]oxy]-13-[(2R)-5-oxooxolan-2-yl]tridecyl] trifluoromethanesulfonate.
| Compound Name | [(2R,13R)-2,13-bis[[tert-butyl(dimethyl)silyl]oxy]-13-[(2R)-5-oxooxolan-2-yl]tridecyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11239329 |
| Molecular Formula | C30H59F3O7SSi2 |
| Molecular Weight | 677.03 g/mol |
| Exact Mass | 676.35 |
| IUPAC Name | [(2R,13R)-2,13-bis[[tert-butyl(dimethyl)silyl]oxy]-13-[(2R)-5-oxooxolan-2-yl]tridecyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CCCCCCCCCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CCC(=O)O1)COS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C30H59F3O7SSi2/c1-28(2,3)42(7,8)39-24(23-37-41(35,36)30(31,32)33)19-17-15-13-11-12-14-16-18-20-26(25-21-22-27(34)38-25)40-43(9,10)29(4,5)6/h24-26H,11-23H2,1-10H3/t24-,25-,26-/m1/s1 |
| InChIKey | UCJIMYKISAZQCF-TWJOJJKGSA-N |
| XLogP | 9.24 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.03 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|