C42H48N4O4S — CID 11239468
N-[2-[4-oxo-4-(4-piperidin-1-ylpiperidin-1-yl)butoxy]-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]-2-phenylbenzamide (PubChem CID 11239468) has the molecular formula C42H48N4O4S and a molecular weight of 704.94 g/mol. Its IUPAC name is N-[2-[4-oxo-4-(4-piperidin-1-ylpiperidin-1-yl)butoxy]-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]-2-phenylbenzamide.
| Compound Name | N-[2-[4-oxo-4-(4-piperidin-1-ylpiperidin-1-yl)butoxy]-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 11239468 |
| Molecular Formula | C42H48N4O4S |
| Molecular Weight | 704.94 g/mol |
| Exact Mass | 704.34 |
| IUPAC Name | N-[2-[4-oxo-4-(4-piperidin-1-ylpiperidin-1-yl)butoxy]-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]-2-phenylbenzamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCCCc3sccc32)cc1OCCCC(=O)N1CCC(N2CCCCC2)CC1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C42H48N4O4S/c47-40(45-26-20-33(21-27-45)44-23-8-2-9-24-44)17-11-28-50-38-30-32(42(49)46-25-10-7-16-39-37(46)22-29-51-39)18-19-36(38)43-41(48)35-15-6-5-14-34(35)31-12-3-1-4-13-31/h1,3-6,12-15,18-19,22,29-30,33H,2,7-11,16-17,20-21,23-28H2,(H,43,48) |
| InChIKey | GBOCTZMLOKKIHJ-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.94 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|