C42H44O17S — CID 11239903
[(2R,3R,4R,5R,6S)-4,5-dibenzoyloxy-6-methoxy-3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyloxan-2-yl]methyl benzoate (PubChem CID 11239903) has the molecular formula C42H44O17S and a molecular weight of 852.86 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-4,5-dibenzoyloxy-6-methoxy-3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyloxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R,6S)-4,5-dibenzoyloxy-6-methoxy-3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11239903 |
| Molecular Formula | C42H44O17S |
| Molecular Weight | 852.86 g/mol |
| Exact Mass | 852.23 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-4,5-dibenzoyloxy-6-methoxy-3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyloxan-2-yl]methyl benzoate |
| SMILES | CO[C@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](S[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C42H44O17S/c1-23(43)51-21-30-32(53-24(2)44)33(54-25(3)45)36(55-26(4)46)42(57-30)60-37-31(22-52-38(47)27-15-9-6-10-16-27)56-41(50-5)35(59-40(49)29-19-13-8-14-20-29)34(37)58-39(48)28-17-11-7-12-18-28/h6-20,30-37,41-42H,21-22H2,1-5H3/t30-,31-,32-,33+,34-,35-,36-,37-,41+,42+/m1/s1 |
| InChIKey | GBPUCYAICHAPSZ-HOPBJPDBSA-N |
| XLogP | 3.85 |
| TPSA | 211.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.86 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|