About 2-methyl(213C)propane
2-methyl(213C)propane (PubChem CID 11240418) has the molecular formula C4H10
and a molecular weight of 59.12 g/mol. Its IUPAC name is 2-methyl(213C)propane.
Molecular Properties
| Compound Name | 2-methyl(213C)propane |
| PubChem CID | 11240418 |
| Molecular Formula | C4H10 |
| Molecular Weight | 59.12 g/mol |
| Exact Mass | 59.08 |
| IUPAC Name | 2-methyl(213C)propane |
| SMILES | C[13CH](C)C |
| InChI | InChI=1S/C4H10/c1-4(2)3/h4H,1-3H3/i4+1 |
| InChIKey | NNPPMTNAJDCUHE-AZXPZELESA-N |
| XLogP | 1.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 59.12 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methyl(213C)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl(213C)propane?
The IUPAC name of 2-methyl(213C)propane (CID 11240418) is 2-methyl(213C)propane.
What is the SMILES notation for 2-methyl(213C)propane?
The canonical SMILES for 2-methyl(213C)propane is C[13CH](C)C.
What is the InChIKey of 2-methyl(213C)propane?
The InChIKey is NNPPMTNAJDCUHE-AZXPZELESA-N. The full InChI is InChI=1S/C4H10/c1-4(2)3/h4H,1-3H3/i4+1.
What are the key properties of 2-methyl(213C)propane?
2-methyl(213C)propane has a molecular weight of 59.12 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl(213C)propane is sourced from PubChem (CID 11240418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).