About 2-azaspiro[5.5]undeca-1,9-diene
2-azaspiro[5.5]undeca-1,9-diene (PubChem CID 11240575) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 2-azaspiro[5.5]undeca-1,9-diene.
Molecular Properties
| Compound Name | 2-azaspiro[5.5]undeca-1,9-diene |
| PubChem CID | 11240575 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 2-azaspiro[5.5]undeca-1,9-diene |
| SMILES | C1=CCC2(C=NCCC2)CC1 |
| InChI | InChI=1S/C10H15N/c1-2-5-10(6-3-1)7-4-8-11-9-10/h1-2,9H,3-8H2 |
| InChIKey | UQOAMFVVWQWGNH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-azaspiro[5.5]undeca-1,9-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaspiro[5.5]undeca-1,9-diene?
The IUPAC name of 2-azaspiro[5.5]undeca-1,9-diene (CID 11240575) is 2-azaspiro[5.5]undeca-1,9-diene.
What is the SMILES notation for 2-azaspiro[5.5]undeca-1,9-diene?
The canonical SMILES for 2-azaspiro[5.5]undeca-1,9-diene is C1=CCC2(C=NCCC2)CC1.
What is the InChIKey of 2-azaspiro[5.5]undeca-1,9-diene?
The InChIKey is UQOAMFVVWQWGNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-2-5-10(6-3-1)7-4-8-11-9-10/h1-2,9H,3-8H2.
What are the key properties of 2-azaspiro[5.5]undeca-1,9-diene?
2-azaspiro[5.5]undeca-1,9-diene has a molecular weight of 149.24 g/mol, XLogP of 2.58, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaspiro[5.5]undeca-1,9-diene is sourced from PubChem (CID 11240575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).