About 3-amino-4,5,5-trimethylheptanoic acid
3-amino-4,5,5-trimethylheptanoic acid (PubChem CID 11240894) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 3-amino-4,5,5-trimethylheptanoic acid.
Molecular Properties
| Compound Name | 3-amino-4,5,5-trimethylheptanoic acid |
| PubChem CID | 11240894 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 3-amino-4,5,5-trimethylheptanoic acid |
| SMILES | CCC(C)(C)C(C)C(N)CC(=O)O |
| InChI | InChI=1S/C10H21NO2/c1-5-10(3,4)7(2)8(11)6-9(12)13/h7-8H,5-6,11H2,1-4H3,(H,12,13) |
| InChIKey | YGNUEECSUZYAQR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-4,5,5-trimethylheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,5,5-trimethylheptanoic acid?
The IUPAC name of 3-amino-4,5,5-trimethylheptanoic acid (CID 11240894) is 3-amino-4,5,5-trimethylheptanoic acid.
What is the SMILES notation for 3-amino-4,5,5-trimethylheptanoic acid?
The canonical SMILES for 3-amino-4,5,5-trimethylheptanoic acid is CCC(C)(C)C(C)C(N)CC(=O)O.
What is the InChIKey of 3-amino-4,5,5-trimethylheptanoic acid?
The InChIKey is YGNUEECSUZYAQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-5-10(3,4)7(2)8(11)6-9(12)13/h7-8H,5-6,11H2,1-4H3,(H,12,13).
What are the key properties of 3-amino-4,5,5-trimethylheptanoic acid?
3-amino-4,5,5-trimethylheptanoic acid has a molecular weight of 187.28 g/mol, XLogP of 1.86, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,5,5-trimethylheptanoic acid is sourced from PubChem (CID 11240894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).