C12H18O2 — CID 11240994
3-methyl-2-[(E,2R)-pent-3-en-2-yl]oxycyclohex-2-en-1-one (PubChem CID 11240994) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 3-methyl-2-[(E,2R)-pent-3-en-2-yl]oxycyclohex-2-en-1-one.
| Compound Name | 3-methyl-2-[(E,2R)-pent-3-en-2-yl]oxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11240994 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-methyl-2-[(E,2R)-pent-3-en-2-yl]oxycyclohex-2-en-1-one |
| SMILES | C/C=C/[C@@H](C)OC1=C(C)CCCC1=O |
| InChI | InChI=1S/C12H18O2/c1-4-6-10(3)14-12-9(2)7-5-8-11(12)13/h4,6,10H,5,7-8H2,1-3H3/b6-4+/t10-/m1/s1 |
| InChIKey | WPQLQGKHRKHHGI-DFVUYQKZSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|