About 3-amino-4,5,5-trimethyloctanoic acid
3-amino-4,5,5-trimethyloctanoic acid (PubChem CID 11241099) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-amino-4,5,5-trimethyloctanoic acid.
Molecular Properties
| Compound Name | 3-amino-4,5,5-trimethyloctanoic acid |
| PubChem CID | 11241099 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 3-amino-4,5,5-trimethyloctanoic acid |
| SMILES | CCCC(C)(C)C(C)C(N)CC(=O)O |
| InChI | InChI=1S/C11H23NO2/c1-5-6-11(3,4)8(2)9(12)7-10(13)14/h8-9H,5-7,12H2,1-4H3,(H,13,14) |
| InChIKey | OHDCYZMOSYFBTF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-4,5,5-trimethyloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,5,5-trimethyloctanoic acid?
The IUPAC name of 3-amino-4,5,5-trimethyloctanoic acid (CID 11241099) is 3-amino-4,5,5-trimethyloctanoic acid.
What is the SMILES notation for 3-amino-4,5,5-trimethyloctanoic acid?
The canonical SMILES for 3-amino-4,5,5-trimethyloctanoic acid is CCCC(C)(C)C(C)C(N)CC(=O)O.
What is the InChIKey of 3-amino-4,5,5-trimethyloctanoic acid?
The InChIKey is OHDCYZMOSYFBTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-5-6-11(3,4)8(2)9(12)7-10(13)14/h8-9H,5-7,12H2,1-4H3,(H,13,14).
What are the key properties of 3-amino-4,5,5-trimethyloctanoic acid?
3-amino-4,5,5-trimethyloctanoic acid has a molecular weight of 201.31 g/mol, XLogP of 2.25, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,5,5-trimethyloctanoic acid is sourced from PubChem (CID 11241099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).