C13H16S — CID 11241164
(1S,2R,6S,7R)-5-prop-2-enylsulfanyltricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 11241164) has the molecular formula C13H16S and a molecular weight of 204.34 g/mol. Its IUPAC name is (1S,2R,6S,7R)-5-prop-2-enylsulfanyltricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | (1S,2R,6S,7R)-5-prop-2-enylsulfanyltricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 11241164 |
| Molecular Formula | C13H16S |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (1S,2R,6S,7R)-5-prop-2-enylsulfanyltricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C=CCSC1C=C[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C13H16S/c1-2-7-14-12-6-5-11-9-3-4-10(8-9)13(11)12/h2-6,9-13H,1,7-8H2/t9-,10+,11-,12?,13+/m1/s1 |
| InChIKey | QKBGCSYKWCCGBL-WUUNYJKSSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|