About 4-chloro-1,1,1-trifluoro-2-(trifluoromethyl)but-2-ene
4-chloro-1,1,1-trifluoro-2-(trifluoromethyl)but-2-ene (PubChem CID 11241329) has the molecular formula C5H3ClF6
and a molecular weight of 212.52 g/mol. Its IUPAC name is 4-chloro-1,1,1-trifluoro-2-(trifluoromethyl)but-2-ene.
Molecular Properties
| Compound Name | 4-chloro-1,1,1-trifluoro-2-(trifluoromethyl)but-2-ene |
| PubChem CID | 11241329 |
| Molecular Formula | C5H3ClF6 |
| Molecular Weight | 212.52 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 4-chloro-1,1,1-trifluoro-2-(trifluoromethyl)but-2-ene |
| SMILES | FC(F)(F)C(=CCCl)C(F)(F)F |
| InChI | InChI=1S/C5H3ClF6/c6-2-1-3(4(7,8)9)5(10,11)12/h1H,2H2 |
| InChIKey | RTFLIYYSISYCLF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1,1,1-trifluoro-2-(trifluoromethyl)but-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,1,1-trifluoro-2-(trifluoromethyl)but-2-ene?
The IUPAC name of 4-chloro-1,1,1-trifluoro-2-(trifluoromethyl)but-2-ene (CID 11241329) is 4-chloro-1,1,1-trifluoro-2-(trifluoromethyl)but-2-ene.
What is the SMILES notation for 4-chloro-1,1,1-trifluoro-2-(trifluoromethyl)but-2-ene?
The canonical SMILES for 4-chloro-1,1,1-trifluoro-2-(trifluoromethyl)but-2-ene is FC(F)(F)C(=CCCl)C(F)(F)F.
What is the InChIKey of 4-chloro-1,1,1-trifluoro-2-(trifluoromethyl)but-2-ene?
The InChIKey is RTFLIYYSISYCLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClF6/c6-2-1-3(4(7,8)9)5(10,11)12/h1H,2H2.
What are the key properties of 4-chloro-1,1,1-trifluoro-2-(trifluoromethyl)but-2-ene?
4-chloro-1,1,1-trifluoro-2-(trifluoromethyl)but-2-ene has a molecular weight of 212.52 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,1,1-trifluoro-2-(trifluoromethyl)but-2-ene is sourced from PubChem (CID 11241329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).