C13H14N2O — CID 11241354
(3R)-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole-5-carbonitrile (PubChem CID 11241354) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is (3R)-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole-5-carbonitrile.
| Compound Name | (3R)-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole-5-carbonitrile |
|---|---|
| PubChem CID | 11241354 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (3R)-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole-5-carbonitrile |
| SMILES | N#CC1CCC2OC[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C13H14N2O/c14-8-11-6-7-13-15(11)12(9-16-13)10-4-2-1-3-5-10/h1-5,11-13H,6-7,9H2/t11?,12-,13?/m0/s1 |
| InChIKey | YYCQXHJPVNLKOU-CPCZMJQVSA-N |
| XLogP | 2.07 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |