C12H17NO3 — CID 11241553
cis-(3R,4R)-3-(1,3-dioxolan-2-yl)-3,4-dimethyl-2-oxocyclohexane-1-carbonitrile (PubChem CID 11241553) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is cis-(3R,4R)-3-(1,3-dioxolan-2-yl)-3,4-dimethyl-2-oxocyclohexane-1-carbonitrile.
| Compound Name | cis-(3R,4R)-3-(1,3-dioxolan-2-yl)-3,4-dimethyl-2-oxocyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 11241553 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | cis-(3R,4R)-3-(1,3-dioxolan-2-yl)-3,4-dimethyl-2-oxocyclohexane-1-carbonitrile |
| SMILES | C[C@@H]1CCC(C#N)C(=O)[C@@]1(C)C1OCCO1 |
| InChI | InChI=1S/C12H17NO3/c1-8-3-4-9(7-13)10(14)12(8,2)11-15-5-6-16-11/h8-9,11H,3-6H2,1-2H3/t8-,9?,12+/m1/s1 |
| InChIKey | KUWQIKGDTVQSOQ-JGJVNGFWSA-N |
| XLogP | 1.50 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|