About (2R)-1,2-dimethyl-3-naphthalen-2-yl-2,5-dihydropyrrole
(2R)-1,2-dimethyl-3-naphthalen-2-yl-2,5-dihydropyrrole (PubChem CID 11241558) has the molecular formula C16H17N
and a molecular weight of 223.32 g/mol. Its IUPAC name is (2R)-1,2-dimethyl-3-naphthalen-2-yl-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | (2R)-1,2-dimethyl-3-naphthalen-2-yl-2,5-dihydropyrrole |
| PubChem CID | 11241558 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (2R)-1,2-dimethyl-3-naphthalen-2-yl-2,5-dihydropyrrole |
| SMILES | C[C@@H]1C(c2ccc3ccccc3c2)=CCN1C |
| InChI | InChI=1S/C16H17N/c1-12-16(9-10-17(12)2)15-8-7-13-5-3-4-6-14(13)11-15/h3-9,11-12H,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | VRGJFDLECJOTQT-GFCCVEGCSA-N |
| XLogP | 3.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-1,2-dimethyl-3-naphthalen-2-yl-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,2-dimethyl-3-naphthalen-2-yl-2,5-dihydropyrrole?
The IUPAC name of (2R)-1,2-dimethyl-3-naphthalen-2-yl-2,5-dihydropyrrole (CID 11241558) is (2R)-1,2-dimethyl-3-naphthalen-2-yl-2,5-dihydropyrrole.
What is the SMILES notation for (2R)-1,2-dimethyl-3-naphthalen-2-yl-2,5-dihydropyrrole?
The canonical SMILES for (2R)-1,2-dimethyl-3-naphthalen-2-yl-2,5-dihydropyrrole is C[C@@H]1C(c2ccc3ccccc3c2)=CCN1C.
What is the InChIKey of (2R)-1,2-dimethyl-3-naphthalen-2-yl-2,5-dihydropyrrole?
The InChIKey is VRGJFDLECJOTQT-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H17N/c1-12-16(9-10-17(12)2)15-8-7-13-5-3-4-6-14(13)11-15/h3-9,11-12H,10H2,1-2H3/t12-/m1/s1.
What are the key properties of (2R)-1,2-dimethyl-3-naphthalen-2-yl-2,5-dihydropyrrole?
(2R)-1,2-dimethyl-3-naphthalen-2-yl-2,5-dihydropyrrole has a molecular weight of 223.32 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,2-dimethyl-3-naphthalen-2-yl-2,5-dihydropyrrole is sourced from PubChem (CID 11241558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).