About 4-piperidin-1-yl-1,3-benzoxazin-2-one
4-piperidin-1-yl-1,3-benzoxazin-2-one (PubChem CID 11241695) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is 4-piperidin-1-yl-1,3-benzoxazin-2-one.
Molecular Properties
| Compound Name | 4-piperidin-1-yl-1,3-benzoxazin-2-one |
| PubChem CID | 11241695 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4-piperidin-1-yl-1,3-benzoxazin-2-one |
| SMILES | O=c1nc(N2CCCCC2)c2ccccc2o1 |
| InChI | InChI=1S/C13H14N2O2/c16-13-14-12(15-8-4-1-5-9-15)10-6-2-3-7-11(10)17-13/h2-3,6-7H,1,4-5,8-9H2 |
| InChIKey | TWTXAVLIGMDCSB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-piperidin-1-yl-1,3-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-1-yl-1,3-benzoxazin-2-one?
The IUPAC name of 4-piperidin-1-yl-1,3-benzoxazin-2-one (CID 11241695) is 4-piperidin-1-yl-1,3-benzoxazin-2-one.
What is the SMILES notation for 4-piperidin-1-yl-1,3-benzoxazin-2-one?
The canonical SMILES for 4-piperidin-1-yl-1,3-benzoxazin-2-one is O=c1nc(N2CCCCC2)c2ccccc2o1.
What is the InChIKey of 4-piperidin-1-yl-1,3-benzoxazin-2-one?
The InChIKey is TWTXAVLIGMDCSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c16-13-14-12(15-8-4-1-5-9-15)10-6-2-3-7-11(10)17-13/h2-3,6-7H,1,4-5,8-9H2.
What are the key properties of 4-piperidin-1-yl-1,3-benzoxazin-2-one?
4-piperidin-1-yl-1,3-benzoxazin-2-one has a molecular weight of 230.27 g/mol, XLogP of 2.18, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-1-yl-1,3-benzoxazin-2-one is sourced from PubChem (CID 11241695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).