About benzyl 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetate
benzyl 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetate (PubChem CID 11241814) has the molecular formula C12H13NO4
and a molecular weight of 235.24 g/mol. Its IUPAC name is benzyl 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetate.
Molecular Properties
| Compound Name | benzyl 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetate |
| PubChem CID | 11241814 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | benzyl 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetate |
| SMILES | O=C(C[C@H]1COC(=O)N1)OCc1ccccc1 |
| InChI | InChI=1S/C12H13NO4/c14-11(6-10-8-17-12(15)13-10)16-7-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,13,15)/t10-/m0/s1 |
| InChIKey | VFXVGUKENCPCBN-JTQLQIEISA-N |
| XLogP | 1.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetate?
The IUPAC name of benzyl 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetate (CID 11241814) is benzyl 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetate.
What is the SMILES notation for benzyl 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetate?
The canonical SMILES for benzyl 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetate is O=C(C[C@H]1COC(=O)N1)OCc1ccccc1.
What is the InChIKey of benzyl 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetate?
The InChIKey is VFXVGUKENCPCBN-JTQLQIEISA-N. The full InChI is InChI=1S/C12H13NO4/c14-11(6-10-8-17-12(15)13-10)16-7-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,13,15)/t10-/m0/s1.
What are the key properties of benzyl 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetate?
benzyl 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetate has a molecular weight of 235.24 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetate is sourced from PubChem (CID 11241814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).