C15H26O2 — CID 11241890
(1R,4R,5S,7R)-4-hydroxy-1,4,7,9,9-pentamethylspiro[4.5]decan-3-one (PubChem CID 11241890) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (1R,4R,5S,7R)-4-hydroxy-1,4,7,9,9-pentamethylspiro[4.5]decan-3-one.
| Compound Name | (1R,4R,5S,7R)-4-hydroxy-1,4,7,9,9-pentamethylspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 11241890 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (1R,4R,5S,7R)-4-hydroxy-1,4,7,9,9-pentamethylspiro[4.5]decan-3-one |
| SMILES | C[C@@H]1CC(C)(C)C[C@@]2(C1)[C@H](C)CC(=O)[C@]2(C)O |
| InChI | InChI=1S/C15H26O2/c1-10-7-13(3,4)9-15(8-10)11(2)6-12(16)14(15,5)17/h10-11,17H,6-9H2,1-5H3/t10-,11-,14+,15+/m1/s1 |
| InChIKey | QCLSGPJMSACEKN-FIXIBIHLSA-N |
| XLogP | 3.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |