About 4-(2-amino-1-hydroxyethyl)phenol;ethyl hydrogen carbonate
4-(2-amino-1-hydroxyethyl)phenol;ethyl hydrogen carbonate (PubChem CID 11241982) has the molecular formula C11H17NO5
and a molecular weight of 243.26 g/mol. Its IUPAC name is 4-(2-amino-1-hydroxyethyl)phenol;ethyl hydrogen carbonate.
Molecular Properties
| Compound Name | 4-(2-amino-1-hydroxyethyl)phenol;ethyl hydrogen carbonate |
| PubChem CID | 11241982 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 4-(2-amino-1-hydroxyethyl)phenol;ethyl hydrogen carbonate |
| SMILES | CCOC(=O)O.NCC(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H11NO2.C3H6O3/c9-5-8(11)6-1-3-7(10)4-2-6;1-2-6-3(4)5/h1-4,8,10-11H,5,9H2;2H2,1H3,(H,4,5) |
| InChIKey | KTRVSOQLASFUPD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-amino-1-hydroxyethyl)phenol;ethyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-1-hydroxyethyl)phenol;ethyl hydrogen carbonate?
The IUPAC name of 4-(2-amino-1-hydroxyethyl)phenol;ethyl hydrogen carbonate (CID 11241982) is 4-(2-amino-1-hydroxyethyl)phenol;ethyl hydrogen carbonate.
What is the SMILES notation for 4-(2-amino-1-hydroxyethyl)phenol;ethyl hydrogen carbonate?
The canonical SMILES for 4-(2-amino-1-hydroxyethyl)phenol;ethyl hydrogen carbonate is CCOC(=O)O.NCC(O)c1ccc(O)cc1.
What is the InChIKey of 4-(2-amino-1-hydroxyethyl)phenol;ethyl hydrogen carbonate?
The InChIKey is KTRVSOQLASFUPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2.C3H6O3/c9-5-8(11)6-1-3-7(10)4-2-6;1-2-6-3(4)5/h1-4,8,10-11H,5,9H2;2H2,1H3,(H,4,5).
What are the key properties of 4-(2-amino-1-hydroxyethyl)phenol;ethyl hydrogen carbonate?
4-(2-amino-1-hydroxyethyl)phenol;ethyl hydrogen carbonate has a molecular weight of 243.26 g/mol, XLogP of 1.09, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-1-hydroxyethyl)phenol;ethyl hydrogen carbonate is sourced from PubChem (CID 11241982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).