About 3-chlorobut-1-ene
3-chlorobut-1-ene (PubChem CID 11242) has the molecular formula C4H7Cl
and a molecular weight of 90.55 g/mol. Its IUPAC name is 3-chlorobut-1-ene.
Molecular Properties
| Compound Name | 3-chlorobut-1-ene |
| PubChem CID | 11242 |
| Molecular Formula | C4H7Cl |
| Molecular Weight | 90.55 g/mol |
| Exact Mass | 90.02 |
| IUPAC Name | 3-chlorobut-1-ene |
| SMILES | C=CC(C)Cl |
| InChI | InChI=1S/C4H7Cl/c1-3-4(2)5/h3-4H,1H2,2H3 |
| InChIKey | VZGLVCFVUREVDP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.55 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobut-1-ene?
The IUPAC name of 3-chlorobut-1-ene (CID 11242) is 3-chlorobut-1-ene.
What is the SMILES notation for 3-chlorobut-1-ene?
The canonical SMILES for 3-chlorobut-1-ene is C=CC(C)Cl.
What is the InChIKey of 3-chlorobut-1-ene?
The InChIKey is VZGLVCFVUREVDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7Cl/c1-3-4(2)5/h3-4H,1H2,2H3.
What are the key properties of 3-chlorobut-1-ene?
3-chlorobut-1-ene has a molecular weight of 90.55 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobut-1-ene is sourced from PubChem (CID 11242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).