About 1-[(1S,2R,5S)-1-phenylsulfanyl-2-bicyclo[3.2.0]heptanyl]ethanone
1-[(1S,2R,5S)-1-phenylsulfanyl-2-bicyclo[3.2.0]heptanyl]ethanone (PubChem CID 11242052) has the molecular formula C15H18OS
and a molecular weight of 246.37 g/mol. Its IUPAC name is 1-[(1S,2R,5S)-1-phenylsulfanyl-2-bicyclo[3.2.0]heptanyl]ethanone.
Molecular Properties
| Compound Name | 1-[(1S,2R,5S)-1-phenylsulfanyl-2-bicyclo[3.2.0]heptanyl]ethanone |
| PubChem CID | 11242052 |
| Molecular Formula | C15H18OS |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1-[(1S,2R,5S)-1-phenylsulfanyl-2-bicyclo[3.2.0]heptanyl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@H]2CC[C@]21Sc1ccccc1 |
| InChI | InChI=1S/C15H18OS/c1-11(16)14-8-7-12-9-10-15(12,14)17-13-5-3-2-4-6-13/h2-6,12,14H,7-10H2,1H3/t12-,14+,15-/m0/s1 |
| InChIKey | CCLIZQOVTSMVMN-CFVMTHIKSA-N |
| XLogP | 3.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1S,2R,5S)-1-phenylsulfanyl-2-bicyclo[3.2.0]heptanyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2R,5S)-1-phenylsulfanyl-2-bicyclo[3.2.0]heptanyl]ethanone?
The IUPAC name of 1-[(1S,2R,5S)-1-phenylsulfanyl-2-bicyclo[3.2.0]heptanyl]ethanone (CID 11242052) is 1-[(1S,2R,5S)-1-phenylsulfanyl-2-bicyclo[3.2.0]heptanyl]ethanone.
What is the SMILES notation for 1-[(1S,2R,5S)-1-phenylsulfanyl-2-bicyclo[3.2.0]heptanyl]ethanone?
The canonical SMILES for 1-[(1S,2R,5S)-1-phenylsulfanyl-2-bicyclo[3.2.0]heptanyl]ethanone is CC(=O)[C@H]1CC[C@H]2CC[C@]21Sc1ccccc1.
What is the InChIKey of 1-[(1S,2R,5S)-1-phenylsulfanyl-2-bicyclo[3.2.0]heptanyl]ethanone?
The InChIKey is CCLIZQOVTSMVMN-CFVMTHIKSA-N. The full InChI is InChI=1S/C15H18OS/c1-11(16)14-8-7-12-9-10-15(12,14)17-13-5-3-2-4-6-13/h2-6,12,14H,7-10H2,1H3/t12-,14+,15-/m0/s1.
What are the key properties of 1-[(1S,2R,5S)-1-phenylsulfanyl-2-bicyclo[3.2.0]heptanyl]ethanone?
1-[(1S,2R,5S)-1-phenylsulfanyl-2-bicyclo[3.2.0]heptanyl]ethanone has a molecular weight of 246.37 g/mol, XLogP of 3.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2R,5S)-1-phenylsulfanyl-2-bicyclo[3.2.0]heptanyl]ethanone is sourced from PubChem (CID 11242052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).