C10H4F2N4O2 — CID 11242143
4-(3,5-dioxo-1,2,4-triazin-2-yl)-2,5-difluorobenzonitrile (PubChem CID 11242143) has the molecular formula C10H4F2N4O2 and a molecular weight of 250.16 g/mol. Its IUPAC name is 4-(3,5-dioxo-1,2,4-triazin-2-yl)-2,5-difluorobenzonitrile.
| Compound Name | 4-(3,5-dioxo-1,2,4-triazin-2-yl)-2,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 11242143 |
| Molecular Formula | C10H4F2N4O2 |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 4-(3,5-dioxo-1,2,4-triazin-2-yl)-2,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(-n2ncc(=O)[nH]c2=O)cc1F |
| InChI | InChI=1S/C10H4F2N4O2/c11-6-2-8(7(12)1-5(6)3-13)16-10(18)15-9(17)4-14-16/h1-2,4H,(H,15,17,18) |
| InChIKey | OLMYNIRXAFGGPD-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |