About 12H-quinolino[3,4-b][1,4]benzothiazine
12H-quinolino[3,4-b][1,4]benzothiazine (PubChem CID 11242149) has the molecular formula C15H10N2S
and a molecular weight of 250.33 g/mol. Its IUPAC name is 12H-quinolino[3,4-b][1,4]benzothiazine.
Molecular Properties
| Compound Name | 12H-quinolino[3,4-b][1,4]benzothiazine |
| PubChem CID | 11242149 |
| Molecular Formula | C15H10N2S |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 12H-quinolino[3,4-b][1,4]benzothiazine |
| SMILES | c1ccc2c(c1)Nc1c(cnc3ccccc13)S2 |
| InChI | InChI=1S/C15H10N2S/c1-2-6-11-10(5-1)15-14(9-16-11)18-13-8-4-3-7-12(13)17-15/h1-9,17H |
| InChIKey | PCJUZVZEBDPWTK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 12H-quinolino[3,4-b][1,4]benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12H-quinolino[3,4-b][1,4]benzothiazine?
The IUPAC name of 12H-quinolino[3,4-b][1,4]benzothiazine (CID 11242149) is 12H-quinolino[3,4-b][1,4]benzothiazine.
What is the SMILES notation for 12H-quinolino[3,4-b][1,4]benzothiazine?
The canonical SMILES for 12H-quinolino[3,4-b][1,4]benzothiazine is c1ccc2c(c1)Nc1c(cnc3ccccc13)S2.
What is the InChIKey of 12H-quinolino[3,4-b][1,4]benzothiazine?
The InChIKey is PCJUZVZEBDPWTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2S/c1-2-6-11-10(5-1)15-14(9-16-11)18-13-8-4-3-7-12(13)17-15/h1-9,17H.
What are the key properties of 12H-quinolino[3,4-b][1,4]benzothiazine?
12H-quinolino[3,4-b][1,4]benzothiazine has a molecular weight of 250.33 g/mol, XLogP of 4.44, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 12H-quinolino[3,4-b][1,4]benzothiazine is sourced from PubChem (CID 11242149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).