About 5,5-dimethylhexa-2,3-dienyl diethyl phosphate
5,5-dimethylhexa-2,3-dienyl diethyl phosphate (PubChem CID 11242468) has the molecular formula C12H23O4P
and a molecular weight of 262.29 g/mol. Its IUPAC name is 5,5-dimethylhexa-2,3-dienyl diethyl phosphate.
Molecular Properties
| Compound Name | 5,5-dimethylhexa-2,3-dienyl diethyl phosphate |
| PubChem CID | 11242468 |
| Molecular Formula | C12H23O4P |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 5,5-dimethylhexa-2,3-dienyl diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OCC=C=CC(C)(C)C |
| InChI | InChI=1S/C12H23O4P/c1-6-14-17(13,15-7-2)16-11-9-8-10-12(3,4)5/h9-10H,6-7,11H2,1-5H3 |
| InChIKey | VEVDBJLMMNWCHF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethylhexa-2,3-dienyl diethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethylhexa-2,3-dienyl diethyl phosphate?
The IUPAC name of 5,5-dimethylhexa-2,3-dienyl diethyl phosphate (CID 11242468) is 5,5-dimethylhexa-2,3-dienyl diethyl phosphate.
What is the SMILES notation for 5,5-dimethylhexa-2,3-dienyl diethyl phosphate?
The canonical SMILES for 5,5-dimethylhexa-2,3-dienyl diethyl phosphate is CCOP(=O)(OCC)OCC=C=CC(C)(C)C.
What is the InChIKey of 5,5-dimethylhexa-2,3-dienyl diethyl phosphate?
The InChIKey is VEVDBJLMMNWCHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23O4P/c1-6-14-17(13,15-7-2)16-11-9-8-10-12(3,4)5/h9-10H,6-7,11H2,1-5H3.
What are the key properties of 5,5-dimethylhexa-2,3-dienyl diethyl phosphate?
5,5-dimethylhexa-2,3-dienyl diethyl phosphate has a molecular weight of 262.29 g/mol, XLogP of 3.94, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethylhexa-2,3-dienyl diethyl phosphate is sourced from PubChem (CID 11242468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).