C15H20O4 — CID 11242514
(3S,4aR,8aS)-5,5-dimethyl-3-(5-oxo-2H-furan-3-yl)-4,4a,6,7,8,8a-hexahydro-3H-isochromen-1-one (PubChem CID 11242514) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (3S,4aR,8aS)-5,5-dimethyl-3-(5-oxo-2H-furan-3-yl)-4,4a,6,7,8,8a-hexahydro-3H-isochromen-1-one.
| Compound Name | (3S,4aR,8aS)-5,5-dimethyl-3-(5-oxo-2H-furan-3-yl)-4,4a,6,7,8,8a-hexahydro-3H-isochromen-1-one |
|---|---|
| PubChem CID | 11242514 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (3S,4aR,8aS)-5,5-dimethyl-3-(5-oxo-2H-furan-3-yl)-4,4a,6,7,8,8a-hexahydro-3H-isochromen-1-one |
| SMILES | CC1(C)CCC[C@@H]2C(=O)O[C@H](C3=CC(=O)OC3)C[C@H]21 |
| InChI | InChI=1S/C15H20O4/c1-15(2)5-3-4-10-11(15)7-12(19-14(10)17)9-6-13(16)18-8-9/h6,10-12H,3-5,7-8H2,1-2H3/t10-,11+,12-/m0/s1 |
| InChIKey | PBCWIAUDNNFHNW-TUAOUCFPSA-N |
| XLogP | 2.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |