C18H27NO — CID 11242777
(NE)-N-[(3E,5E,7E)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-ylidene]hydroxylamine (PubChem CID 11242777) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is (NE)-N-[(3E,5E,7E)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(3E,5E,7E)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 11242777 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (NE)-N-[(3E,5E,7E)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-ylidene]hydroxylamine |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=N/O)C(C)(C)CCC1 |
| InChI | InChI=1S/C18H27NO/c1-14(8-6-10-16(3)19-20)11-12-17-15(2)9-7-13-18(17,4)5/h6,8,10-12,20H,7,9,13H2,1-5H3/b10-6+,12-11+,14-8+,19-16+ |
| InChIKey | BZRMPPLSXVTQBW-WXBXRRPLSA-N |
| XLogP | 5.42 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|