C15H18O5 — CID 11242905
(3aR,4R,5aS,8bR)-3a,4-dihydroxy-8b-methyl-5a-prop-2-enyl-1,4,5,6-tetrahydrocyclopenta[e][2]benzofuran-3,7-dione (PubChem CID 11242905) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (3aR,4R,5aS,8bR)-3a,4-dihydroxy-8b-methyl-5a-prop-2-enyl-1,4,5,6-tetrahydrocyclopenta[e][2]benzofuran-3,7-dione.
| Compound Name | (3aR,4R,5aS,8bR)-3a,4-dihydroxy-8b-methyl-5a-prop-2-enyl-1,4,5,6-tetrahydrocyclopenta[e][2]benzofuran-3,7-dione |
|---|---|
| PubChem CID | 11242905 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (3aR,4R,5aS,8bR)-3a,4-dihydroxy-8b-methyl-5a-prop-2-enyl-1,4,5,6-tetrahydrocyclopenta[e][2]benzofuran-3,7-dione |
| SMILES | C=CC[C@]12CC(=O)C=C1[C@]1(C)COC(=O)[C@]1(O)[C@H](O)C2 |
| InChI | InChI=1S/C15H18O5/c1-3-4-14-6-9(16)5-10(14)13(2)8-20-12(18)15(13,19)11(17)7-14/h3,5,11,17,19H,1,4,6-8H2,2H3/t11-,13+,14-,15-/m1/s1 |
| InChIKey | CRTRFGUOKFWTOF-FAAHXZRKSA-N |
| XLogP | 0.51 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|