C17H26O3 — CID 11242918
2-[(5R,8S,8aR)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]propan-2-yl acetate (PubChem CID 11242918) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-[(5R,8S,8aR)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]propan-2-yl acetate.
| Compound Name | 2-[(5R,8S,8aR)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]propan-2-yl acetate |
|---|---|
| PubChem CID | 11242918 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2-[(5R,8S,8aR)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]propan-2-yl acetate |
| SMILES | CC(=O)OC(C)(C)[C@@H]1CC[C@H](C)[C@H]2CC(=O)C(C)=C2C1 |
| InChI | InChI=1S/C17H26O3/c1-10-6-7-13(17(4,5)20-12(3)18)8-15-11(2)16(19)9-14(10)15/h10,13-14H,6-9H2,1-5H3/t10-,13+,14+/m0/s1 |
| InChIKey | XSCWYZSJUHXLPX-ZLKJLUDKSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |